C9H10F3NOS2 — CID 86219011
5-(methoxymethyl)-2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazole (PubChem CID 86219011) has the molecular formula C9H10F3NOS2 and a molecular weight of 269.31 g/mol. Its IUPAC name is 5-(methoxymethyl)-2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazole.
| Compound Name | 5-(methoxymethyl)-2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazole |
|---|---|
| PubChem CID | 86219011 |
| Molecular Formula | C9H10F3NOS2 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 5-(methoxymethyl)-2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazole |
| SMILES | COCc1cnc(SCCC(F)=C(F)F)s1 |
| InChI | InChI=1S/C9H10F3NOS2/c1-14-5-6-4-13-9(16-6)15-3-2-7(10)8(11)12/h4H,2-3,5H2,1H3 |
| InChIKey | AFHOSJHAADOTMF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|