C5ClF9O — CID 86219176
2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-2,3,3-trifluorooxirane (PubChem CID 86219176) has the molecular formula C5ClF9O and a molecular weight of 282.49 g/mol. Its IUPAC name is 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-2,3,3-trifluorooxirane.
| Compound Name | 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-2,3,3-trifluorooxirane |
|---|---|
| PubChem CID | 86219176 |
| Molecular Formula | C5ClF9O |
| Molecular Weight | 282.49 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-2,3,3-trifluorooxirane |
| SMILES | FC(F)(Cl)C(F)(F)C(F)(F)C1(F)OC1(F)F |
| InChI | InChI=1S/C5ClF9O/c6-4(12,13)2(9,10)1(7,8)3(11)5(14,15)16-3 |
| InChIKey | QZWJGHOHZMYWBM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|