C27H37N3O2 — CID 8621939
2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-N-[3-(2,3,5-trimethylphenoxy)propyl]acetamide (PubChem CID 8621939) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is 2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-N-[3-(2,3,5-trimethylphenoxy)propyl]acetamide.
| Compound Name | 2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-N-[3-(2,3,5-trimethylphenoxy)propyl]acetamide |
|---|---|
| PubChem CID | 8621939 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | 2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-N-[3-(2,3,5-trimethylphenoxy)propyl]acetamide |
| SMILES | Cc1cc(C)c(C)c(OCCCNC(=O)CN2CCN(C/C=C/c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H37N3O2/c1-22-19-23(2)24(3)26(20-22)32-18-8-12-28-27(31)21-30-16-14-29(15-17-30)13-7-11-25-9-5-4-6-10-25/h4-7,9-11,19-20H,8,12-18,21H2,1-3H3,(H,28,31)/b11-7+ |
| InChIKey | RTTYIBFHAHBKOM-YRNVUSSQSA-N |
| XLogP | 3.83 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|