C9H10BrClN2S — CID 86221900
3-(2-bromo-4-chlorophenyl)-1,1-dimethylthiourea (PubChem CID 86221900) has the molecular formula C9H10BrClN2S and a molecular weight of 293.62 g/mol. Its IUPAC name is 3-(2-bromo-4-chlorophenyl)-1,1-dimethylthiourea.
| Compound Name | 3-(2-bromo-4-chlorophenyl)-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 86221900 |
| Molecular Formula | C9H10BrClN2S |
| Molecular Weight | 293.62 g/mol |
| Exact Mass | 291.94 |
| IUPAC Name | 3-(2-bromo-4-chlorophenyl)-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)Nc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C9H10BrClN2S/c1-13(2)9(14)12-8-4-3-6(11)5-7(8)10/h3-5H,1-2H3,(H,12,14) |
| InChIKey | NBHNOMABXORJOY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.62 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|