About ethyl 2-methylcyclohexa-1,3-diene-1-carboxylate
ethyl 2-methylcyclohexa-1,3-diene-1-carboxylate (PubChem CID 86222235) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is ethyl 2-methylcyclohexa-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-methylcyclohexa-1,3-diene-1-carboxylate |
| PubChem CID | 86222235 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | ethyl 2-methylcyclohexa-1,3-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(C)C=CCC1 |
| InChI | InChI=1S/C10H14O2/c1-3-12-10(11)9-7-5-4-6-8(9)2/h4,6H,3,5,7H2,1-2H3 |
| InChIKey | PEAIIJAOUGKCKP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 2-methylcyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methylcyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of ethyl 2-methylcyclohexa-1,3-diene-1-carboxylate (CID 86222235) is ethyl 2-methylcyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for ethyl 2-methylcyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for ethyl 2-methylcyclohexa-1,3-diene-1-carboxylate is CCOC(=O)C1=C(C)C=CCC1.
What is the InChIKey of ethyl 2-methylcyclohexa-1,3-diene-1-carboxylate?
The InChIKey is PEAIIJAOUGKCKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-3-12-10(11)9-7-5-4-6-8(9)2/h4,6H,3,5,7H2,1-2H3.
What are the key properties of ethyl 2-methylcyclohexa-1,3-diene-1-carboxylate?
ethyl 2-methylcyclohexa-1,3-diene-1-carboxylate has a molecular weight of 166.22 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methylcyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 86222235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).