About 6-pentylpteridine-2,4-diamine
6-pentylpteridine-2,4-diamine (PubChem CID 86222310) has the molecular formula C11H16N6
and a molecular weight of 232.29 g/mol. Its IUPAC name is 6-pentylpteridine-2,4-diamine.
Molecular Properties
| Compound Name | 6-pentylpteridine-2,4-diamine |
| PubChem CID | 86222310 |
| Molecular Formula | C11H16N6 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 6-pentylpteridine-2,4-diamine |
| SMILES | CCCCCc1cnc2nc(N)nc(N)c2n1 |
| InChI | InChI=1S/C11H16N6/c1-2-3-4-5-7-6-14-10-8(15-7)9(12)16-11(13)17-10/h6H,2-5H2,1H3,(H4,12,13,14,16,17) |
| InChIKey | MKBGEZRONFXHEQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-pentylpteridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pentylpteridine-2,4-diamine?
The IUPAC name of 6-pentylpteridine-2,4-diamine (CID 86222310) is 6-pentylpteridine-2,4-diamine.
What is the SMILES notation for 6-pentylpteridine-2,4-diamine?
The canonical SMILES for 6-pentylpteridine-2,4-diamine is CCCCCc1cnc2nc(N)nc(N)c2n1.
What is the InChIKey of 6-pentylpteridine-2,4-diamine?
The InChIKey is MKBGEZRONFXHEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N6/c1-2-3-4-5-7-6-14-10-8(15-7)9(12)16-11(13)17-10/h6H,2-5H2,1H3,(H4,12,13,14,16,17).
What are the key properties of 6-pentylpteridine-2,4-diamine?
6-pentylpteridine-2,4-diamine has a molecular weight of 232.29 g/mol, XLogP of 1.32, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pentylpteridine-2,4-diamine is sourced from PubChem (CID 86222310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).