C18H25N3O3S2 — CID 8622261
1-[[2-[(5-acetyl-2-methoxyphenyl)methylsulfanyl]acetyl]amino]-3-cyclopentylthiourea (PubChem CID 8622261) has the molecular formula C18H25N3O3S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-[[2-[(5-acetyl-2-methoxyphenyl)methylsulfanyl]acetyl]amino]-3-cyclopentylthiourea.
| Compound Name | 1-[[2-[(5-acetyl-2-methoxyphenyl)methylsulfanyl]acetyl]amino]-3-cyclopentylthiourea |
|---|---|
| PubChem CID | 8622261 |
| Molecular Formula | C18H25N3O3S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 1-[[2-[(5-acetyl-2-methoxyphenyl)methylsulfanyl]acetyl]amino]-3-cyclopentylthiourea |
| SMILES | COc1ccc(C(C)=O)cc1CSCC(=O)NNC(=S)NC1CCCC1 |
| InChI | InChI=1S/C18H25N3O3S2/c1-12(22)13-7-8-16(24-2)14(9-13)10-26-11-17(23)20-21-18(25)19-15-5-3-4-6-15/h7-9,15H,3-6,10-11H2,1-2H3,(H,20,23)(H2,19,21,25) |
| InChIKey | SCTXCBKCTUAARD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|