About CID 86222743
CID 86222743 (PubChem CID 86222743) has the molecular formula C20H15N6NaO11S2+
and a molecular weight of 602.50 g/mol.
Molecular Properties
| Compound Name | CID 86222743 |
| PubChem CID | 86222743 |
| Molecular Formula | C20H15N6NaO11S2+ |
| Molecular Weight | 602.50 g/mol |
| Exact Mass | 602.01 |
| IUPAC Name | — |
| SMILES | COc1cc([N+](=O)[O-])ccc1-[n+]1nc(-c2ccc(S(=O)(=O)O)cc2S(=O)(=O)O)nn1-c1ccc([N+](=O)[O-])cc1.[Na] |
| InChI | InChI=1S/C20H14N6O11S2.Na/c1-37-18-10-14(26(29)30)6-9-17(18)24-22-20(21-23(24)12-2-4-13(5-3-12)25(27)28)16-8-7-15(38(31,32)33)11-19(16)39(34,35)36;/h2-11H,1H3,(H-,31,32,33,34,35,36);/p+1 |
| InChIKey | NZUKHYILFXKFSS-UHFFFAOYSA-O |
| XLogP | 1.15 |
| TPSA | 238.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 602.50 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 86222743 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 86222743?
The IUPAC name of CID 86222743 (CID 86222743) is not available.
What is the SMILES notation for CID 86222743?
The canonical SMILES for CID 86222743 is COc1cc([N+](=O)[O-])ccc1-[n+]1nc(-c2ccc(S(=O)(=O)O)cc2S(=O)(=O)O)nn1-c1ccc([N+](=O)[O-])cc1.[Na].
What is the InChIKey of CID 86222743?
The InChIKey is NZUKHYILFXKFSS-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H14N6O11S2.Na/c1-37-18-10-14(26(29)30)6-9-17(18)24-22-20(21-23(24)12-2-4-13(5-3-12)25(27)28)16-8-7-15(38(31,32)33)11-19(16)39(34,35)36;/h2-11H,1H3,(H-,31,32,33,34,35,36);/p+1.
What are the key properties of CID 86222743?
CID 86222743 has a molecular weight of 602.50 g/mol, XLogP of 1.15, 8 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 86222743 is sourced from PubChem (CID 86222743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).