C14H18N2O4 — CID 86223144
3-[3-(2-methoxyanilino)butanoyl]-1,3-oxazolidin-2-one (PubChem CID 86223144) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-[3-(2-methoxyanilino)butanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-(2-methoxyanilino)butanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 86223144 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 3-[3-(2-methoxyanilino)butanoyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccccc1NC(C)CC(=O)N1CCOC1=O |
| InChI | InChI=1S/C14H18N2O4/c1-10(9-13(17)16-7-8-20-14(16)18)15-11-5-3-4-6-12(11)19-2/h3-6,10,15H,7-9H2,1-2H3 |
| InChIKey | XUUGTLDLAACCJC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |