About 2-N,6-N-di(pyrazin-2-yl)pyrazine-2,6-diamine
2-N,6-N-di(pyrazin-2-yl)pyrazine-2,6-diamine (PubChem CID 86223538) has the molecular formula C12H10N8
and a molecular weight of 266.27 g/mol. Its IUPAC name is 2-N,6-N-di(pyrazin-2-yl)pyrazine-2,6-diamine.
Molecular Properties
| Compound Name | 2-N,6-N-di(pyrazin-2-yl)pyrazine-2,6-diamine |
| PubChem CID | 86223538 |
| Molecular Formula | C12H10N8 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2-N,6-N-di(pyrazin-2-yl)pyrazine-2,6-diamine |
| SMILES | c1cnc(Nc2cncc(Nc3cnccn3)n2)cn1 |
| InChI | InChI=1S/C12H10N8/c1-3-16-9(5-13-1)18-11-7-15-8-12(20-11)19-10-6-14-2-4-17-10/h1-8H,(H2,16,17,18,19,20) |
| InChIKey | DQTHHTYMDVDENO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-N,6-N-di(pyrazin-2-yl)pyrazine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,6-N-di(pyrazin-2-yl)pyrazine-2,6-diamine?
The IUPAC name of 2-N,6-N-di(pyrazin-2-yl)pyrazine-2,6-diamine (CID 86223538) is 2-N,6-N-di(pyrazin-2-yl)pyrazine-2,6-diamine.
What is the SMILES notation for 2-N,6-N-di(pyrazin-2-yl)pyrazine-2,6-diamine?
The canonical SMILES for 2-N,6-N-di(pyrazin-2-yl)pyrazine-2,6-diamine is c1cnc(Nc2cncc(Nc3cnccn3)n2)cn1.
What is the InChIKey of 2-N,6-N-di(pyrazin-2-yl)pyrazine-2,6-diamine?
The InChIKey is DQTHHTYMDVDENO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N8/c1-3-16-9(5-13-1)18-11-7-15-8-12(20-11)19-10-6-14-2-4-17-10/h1-8H,(H2,16,17,18,19,20).
What are the key properties of 2-N,6-N-di(pyrazin-2-yl)pyrazine-2,6-diamine?
2-N,6-N-di(pyrazin-2-yl)pyrazine-2,6-diamine has a molecular weight of 266.27 g/mol, XLogP of 1.54, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,6-N-di(pyrazin-2-yl)pyrazine-2,6-diamine is sourced from PubChem (CID 86223538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).