About 5-ethyl-2,3-dihydro-1H-indene-2-carbaldehyde
5-ethyl-2,3-dihydro-1H-indene-2-carbaldehyde (PubChem CID 86227264) has the molecular formula C12H14O
and a molecular weight of 174.24 g/mol. Its IUPAC name is 5-ethyl-2,3-dihydro-1H-indene-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-ethyl-2,3-dihydro-1H-indene-2-carbaldehyde |
| PubChem CID | 86227264 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 5-ethyl-2,3-dihydro-1H-indene-2-carbaldehyde |
| SMILES | CCc1ccc2c(c1)CC(C=O)C2 |
| InChI | InChI=1S/C12H14O/c1-2-9-3-4-11-6-10(8-13)7-12(11)5-9/h3-5,8,10H,2,6-7H2,1H3 |
| InChIKey | NRAQJVFTAGBDFW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2,3-dihydro-1H-indene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,3-dihydro-1H-indene-2-carbaldehyde?
The IUPAC name of 5-ethyl-2,3-dihydro-1H-indene-2-carbaldehyde (CID 86227264) is 5-ethyl-2,3-dihydro-1H-indene-2-carbaldehyde.
What is the SMILES notation for 5-ethyl-2,3-dihydro-1H-indene-2-carbaldehyde?
The canonical SMILES for 5-ethyl-2,3-dihydro-1H-indene-2-carbaldehyde is CCc1ccc2c(c1)CC(C=O)C2.
What is the InChIKey of 5-ethyl-2,3-dihydro-1H-indene-2-carbaldehyde?
The InChIKey is NRAQJVFTAGBDFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O/c1-2-9-3-4-11-6-10(8-13)7-12(11)5-9/h3-5,8,10H,2,6-7H2,1H3.
What are the key properties of 5-ethyl-2,3-dihydro-1H-indene-2-carbaldehyde?
5-ethyl-2,3-dihydro-1H-indene-2-carbaldehyde has a molecular weight of 174.24 g/mol, XLogP of 2.16, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,3-dihydro-1H-indene-2-carbaldehyde is sourced from PubChem (CID 86227264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).