C10H18N2O2S3 — CID 86227329
1,4,7-trithia-10,13-diazacyclopentadecane-9,14-dione (PubChem CID 86227329) has the molecular formula C10H18N2O2S3 and a molecular weight of 294.47 g/mol. Its IUPAC name is 1,4,7-trithia-10,13-diazacyclopentadecane-9,14-dione.
| Compound Name | 1,4,7-trithia-10,13-diazacyclopentadecane-9,14-dione |
|---|---|
| PubChem CID | 86227329 |
| Molecular Formula | C10H18N2O2S3 |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 1,4,7-trithia-10,13-diazacyclopentadecane-9,14-dione |
| SMILES | O=C1CSCCSCCSCC(=O)NCCN1 |
| InChI | InChI=1S/C10H18N2O2S3/c13-9-7-16-5-3-15-4-6-17-8-10(14)12-2-1-11-9/h1-8H2,(H,11,13)(H,12,14) |
| InChIKey | RXWOWEGGZGUDAV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |