About 6-chloro-8-methoxy-3,4-dihydro-2H-chromen-3-amine
6-chloro-8-methoxy-3,4-dihydro-2H-chromen-3-amine (PubChem CID 86227477) has the molecular formula C10H12ClNO2
and a molecular weight of 213.66 g/mol. Its IUPAC name is 6-chloro-8-methoxy-3,4-dihydro-2H-chromen-3-amine.
Molecular Properties
| Compound Name | 6-chloro-8-methoxy-3,4-dihydro-2H-chromen-3-amine |
| PubChem CID | 86227477 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 6-chloro-8-methoxy-3,4-dihydro-2H-chromen-3-amine |
| SMILES | COc1cc(Cl)cc2c1OCC(N)C2 |
| InChI | InChI=1S/C10H12ClNO2/c1-13-9-4-7(11)2-6-3-8(12)5-14-10(6)9/h2,4,8H,3,5,12H2,1H3 |
| InChIKey | DAEKRJBGFQSXBD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-8-methoxy-3,4-dihydro-2H-chromen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-8-methoxy-3,4-dihydro-2H-chromen-3-amine?
The IUPAC name of 6-chloro-8-methoxy-3,4-dihydro-2H-chromen-3-amine (CID 86227477) is 6-chloro-8-methoxy-3,4-dihydro-2H-chromen-3-amine.
What is the SMILES notation for 6-chloro-8-methoxy-3,4-dihydro-2H-chromen-3-amine?
The canonical SMILES for 6-chloro-8-methoxy-3,4-dihydro-2H-chromen-3-amine is COc1cc(Cl)cc2c1OCC(N)C2.
What is the InChIKey of 6-chloro-8-methoxy-3,4-dihydro-2H-chromen-3-amine?
The InChIKey is DAEKRJBGFQSXBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO2/c1-13-9-4-7(11)2-6-3-8(12)5-14-10(6)9/h2,4,8H,3,5,12H2,1H3.
What are the key properties of 6-chloro-8-methoxy-3,4-dihydro-2H-chromen-3-amine?
6-chloro-8-methoxy-3,4-dihydro-2H-chromen-3-amine has a molecular weight of 213.66 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-8-methoxy-3,4-dihydro-2H-chromen-3-amine is sourced from PubChem (CID 86227477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).