C30H42O2 — CID 86228586
1-[4-hydroxy-4-(4-propylphenyl)cyclohexyl]-4-(4-propylphenyl)cyclohexan-1-ol (PubChem CID 86228586) has the molecular formula C30H42O2 and a molecular weight of 434.66 g/mol. Its IUPAC name is 1-[4-hydroxy-4-(4-propylphenyl)cyclohexyl]-4-(4-propylphenyl)cyclohexan-1-ol.
| Compound Name | 1-[4-hydroxy-4-(4-propylphenyl)cyclohexyl]-4-(4-propylphenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 86228586 |
| Molecular Formula | C30H42O2 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | 1-[4-hydroxy-4-(4-propylphenyl)cyclohexyl]-4-(4-propylphenyl)cyclohexan-1-ol |
| SMILES | CCCc1ccc(C2CCC(O)(C3CCC(O)(c4ccc(CCC)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C30H42O2/c1-3-5-23-7-11-25(12-8-23)26-15-19-29(31,20-16-26)28-17-21-30(32,22-18-28)27-13-9-24(6-4-2)10-14-27/h7-14,26,28,31-32H,3-6,15-22H2,1-2H3 |
| InChIKey | ZTELQFDXSWOORP-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |