About 1-isocyanato-4-(1,2,2-trifluoroethenoxy)benzene
1-isocyanato-4-(1,2,2-trifluoroethenoxy)benzene (PubChem CID 86228785) has the molecular formula C9H4F3NO2
and a molecular weight of 215.13 g/mol. Its IUPAC name is 1-isocyanato-4-(1,2,2-trifluoroethenoxy)benzene.
Molecular Properties
| Compound Name | 1-isocyanato-4-(1,2,2-trifluoroethenoxy)benzene |
| PubChem CID | 86228785 |
| Molecular Formula | C9H4F3NO2 |
| Molecular Weight | 215.13 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 1-isocyanato-4-(1,2,2-trifluoroethenoxy)benzene |
| SMILES | O=C=Nc1ccc(OC(F)=C(F)F)cc1 |
| InChI | InChI=1S/C9H4F3NO2/c10-8(11)9(12)15-7-3-1-6(2-4-7)13-5-14/h1-4H |
| InChIKey | MXHHPVOSBDKUKB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.13 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanato-4-(1,2,2-trifluoroethenoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanato-4-(1,2,2-trifluoroethenoxy)benzene?
The IUPAC name of 1-isocyanato-4-(1,2,2-trifluoroethenoxy)benzene (CID 86228785) is 1-isocyanato-4-(1,2,2-trifluoroethenoxy)benzene.
What is the SMILES notation for 1-isocyanato-4-(1,2,2-trifluoroethenoxy)benzene?
The canonical SMILES for 1-isocyanato-4-(1,2,2-trifluoroethenoxy)benzene is O=C=Nc1ccc(OC(F)=C(F)F)cc1.
What is the InChIKey of 1-isocyanato-4-(1,2,2-trifluoroethenoxy)benzene?
The InChIKey is MXHHPVOSBDKUKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F3NO2/c10-8(11)9(12)15-7-3-1-6(2-4-7)13-5-14/h1-4H.
What are the key properties of 1-isocyanato-4-(1,2,2-trifluoroethenoxy)benzene?
1-isocyanato-4-(1,2,2-trifluoroethenoxy)benzene has a molecular weight of 215.13 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanato-4-(1,2,2-trifluoroethenoxy)benzene is sourced from PubChem (CID 86228785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).