About 7,7-difluorohept-6-en-2-ol
7,7-difluorohept-6-en-2-ol (PubChem CID 86229427) has the molecular formula C7H12F2O
and a molecular weight of 150.17 g/mol. Its IUPAC name is 7,7-difluorohept-6-en-2-ol.
Molecular Properties
| Compound Name | 7,7-difluorohept-6-en-2-ol |
| PubChem CID | 86229427 |
| Molecular Formula | C7H12F2O |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 7,7-difluorohept-6-en-2-ol |
| SMILES | CC(O)CCCC=C(F)F |
| InChI | InChI=1S/C7H12F2O/c1-6(10)4-2-3-5-7(8)9/h5-6,10H,2-4H2,1H3 |
| InChIKey | GQJIXKONBZMXJS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7,7-difluorohept-6-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-difluorohept-6-en-2-ol?
The IUPAC name of 7,7-difluorohept-6-en-2-ol (CID 86229427) is 7,7-difluorohept-6-en-2-ol.
What is the SMILES notation for 7,7-difluorohept-6-en-2-ol?
The canonical SMILES for 7,7-difluorohept-6-en-2-ol is CC(O)CCCC=C(F)F.
What is the InChIKey of 7,7-difluorohept-6-en-2-ol?
The InChIKey is GQJIXKONBZMXJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F2O/c1-6(10)4-2-3-5-7(8)9/h5-6,10H,2-4H2,1H3.
What are the key properties of 7,7-difluorohept-6-en-2-ol?
7,7-difluorohept-6-en-2-ol has a molecular weight of 150.17 g/mol, XLogP of 2.32, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-difluorohept-6-en-2-ol is sourced from PubChem (CID 86229427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).