2-methylbenzenesulfonyl chloride

C7H7ClO2S — CID 8623

IUPAC2-methylbenzenesulfonyl chloride
SMILESCc1ccccc1S(=O)(=O)Cl
InChIInChI=1S/C7H7ClO2S/c1-6-4-2-3-5-7(6)11(8,9)10/h2-5H,1H3
InChIKeyHDECRAPHCDXMIJ-UHFFFAOYSA-N
MW190.65 g/mol
LogP1.92
Rot. Bonds1

About 2-methylbenzenesulfonyl chloride

2-methylbenzenesulfonyl chloride (PubChem CID 8623) has the molecular formula C7H7ClO2S and a molecular weight of 190.65 g/mol. Its IUPAC name is 2-methylbenzenesulfonyl chloride.

Molecular Properties

Compound Name2-methylbenzenesulfonyl chloride
PubChem CID8623
Molecular FormulaC7H7ClO2S
Molecular Weight190.65 g/mol
Exact Mass189.99
IUPAC Name2-methylbenzenesulfonyl chloride
SMILESCc1ccccc1S(=O)(=O)Cl
InChIInChI=1S/C7H7ClO2S/c1-6-4-2-3-5-7(6)11(8,9)10/h2-5H,1H3
InChIKeyHDECRAPHCDXMIJ-UHFFFAOYSA-N
XLogP1.92
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.65
LogP ≤ 51.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 2-methylbenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylbenzenesulfonyl chloride?
The IUPAC name of 2-methylbenzenesulfonyl chloride (CID 8623) is 2-methylbenzenesulfonyl chloride.
What is the SMILES notation for 2-methylbenzenesulfonyl chloride?
The canonical SMILES for 2-methylbenzenesulfonyl chloride is Cc1ccccc1S(=O)(=O)Cl.
What is the InChIKey of 2-methylbenzenesulfonyl chloride?
The InChIKey is HDECRAPHCDXMIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO2S/c1-6-4-2-3-5-7(6)11(8,9)10/h2-5H,1H3.
What are the key properties of 2-methylbenzenesulfonyl chloride?
2-methylbenzenesulfonyl chloride has a molecular weight of 190.65 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzenesulfonyl chloride is sourced from PubChem (CID 8623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).