C16H19NO4 — CID 86230438
methyl 2-(1,3-dioxo-1-phenylbutan-2-yl)pyrrolidine-1-carboxylate (PubChem CID 86230438) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl 2-(1,3-dioxo-1-phenylbutan-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | methyl 2-(1,3-dioxo-1-phenylbutan-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86230438 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl 2-(1,3-dioxo-1-phenylbutan-2-yl)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC1C(C(C)=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H19NO4/c1-11(18)14(15(19)12-7-4-3-5-8-12)13-9-6-10-17(13)16(20)21-2/h3-5,7-8,13-14H,6,9-10H2,1-2H3 |
| InChIKey | ZHXUGLVQBSJIRG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|