About zinc bis(ethyl 2-methylidenehexanoate)
zinc bis(ethyl 2-methylidenehexanoate) (PubChem CID 86231831) has the molecular formula C18H30O4Zn
and a molecular weight of 375.82 g/mol. Its IUPAC name is zinc bis(ethyl 2-methylidenehexanoate).
Molecular Properties
| Compound Name | zinc bis(ethyl 2-methylidenehexanoate) |
| PubChem CID | 86231831 |
| Molecular Formula | C18H30O4Zn |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | zinc bis(ethyl 2-methylidenehexanoate) |
| SMILES | C=C(CCC[CH2-])C(=O)OCC.C=C(CCC[CH2-])C(=O)OCC.[Zn+2] |
| InChI | InChI=1S/2C9H15O2.Zn/c2*1-4-6-7-8(3)9(10)11-5-2;/h2*1,3-7H2,2H3;/q2*-1;+2 |
| InChIKey | ZLBDAQLXTCODLI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(ethyl 2-methylidenehexanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(ethyl 2-methylidenehexanoate)?
The IUPAC name of zinc bis(ethyl 2-methylidenehexanoate) (CID 86231831) is zinc bis(ethyl 2-methylidenehexanoate).
What is the SMILES notation for zinc bis(ethyl 2-methylidenehexanoate)?
The canonical SMILES for zinc bis(ethyl 2-methylidenehexanoate) is C=C(CCC[CH2-])C(=O)OCC.C=C(CCC[CH2-])C(=O)OCC.[Zn+2].
What is the InChIKey of zinc bis(ethyl 2-methylidenehexanoate)?
The InChIKey is ZLBDAQLXTCODLI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H15O2.Zn/c2*1-4-6-7-8(3)9(10)11-5-2;/h2*1,3-7H2,2H3;/q2*-1;+2.
What are the key properties of zinc bis(ethyl 2-methylidenehexanoate)?
zinc bis(ethyl 2-methylidenehexanoate) has a molecular weight of 375.82 g/mol, XLogP of 4.22, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(ethyl 2-methylidenehexanoate) is sourced from PubChem (CID 86231831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).