About 1-cyclohexylimino-4,4-dimethylpentan-3-one
1-cyclohexylimino-4,4-dimethylpentan-3-one (PubChem CID 86232034) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is 1-cyclohexylimino-4,4-dimethylpentan-3-one.
Molecular Properties
| Compound Name | 1-cyclohexylimino-4,4-dimethylpentan-3-one |
| PubChem CID | 86232034 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 1-cyclohexylimino-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)C(=O)C/C=N/C1CCCCC1 |
| InChI | InChI=1S/C13H23NO/c1-13(2,3)12(15)9-10-14-11-7-5-4-6-8-11/h10-11H,4-9H2,1-3H3/b14-10+ |
| InChIKey | FZURDPIGUFNGFF-GXDHUFHOSA-N |
| XLogP | 3.40 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylimino-4,4-dimethylpentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylimino-4,4-dimethylpentan-3-one?
The IUPAC name of 1-cyclohexylimino-4,4-dimethylpentan-3-one (CID 86232034) is 1-cyclohexylimino-4,4-dimethylpentan-3-one.
What is the SMILES notation for 1-cyclohexylimino-4,4-dimethylpentan-3-one?
The canonical SMILES for 1-cyclohexylimino-4,4-dimethylpentan-3-one is CC(C)(C)C(=O)C/C=N/C1CCCCC1.
What is the InChIKey of 1-cyclohexylimino-4,4-dimethylpentan-3-one?
The InChIKey is FZURDPIGUFNGFF-GXDHUFHOSA-N. The full InChI is InChI=1S/C13H23NO/c1-13(2,3)12(15)9-10-14-11-7-5-4-6-8-11/h10-11H,4-9H2,1-3H3/b14-10+.
What are the key properties of 1-cyclohexylimino-4,4-dimethylpentan-3-one?
1-cyclohexylimino-4,4-dimethylpentan-3-one has a molecular weight of 209.33 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylimino-4,4-dimethylpentan-3-one is sourced from PubChem (CID 86232034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).