C3H9N5 — CID 86232410
(3-methyl-2,3-dihydro-1H-1,2,4-triazol-5-yl)hydrazine (PubChem CID 86232410) has the molecular formula C3H9N5 and a molecular weight of 115.14 g/mol. Its IUPAC name is (3-methyl-2,3-dihydro-1H-1,2,4-triazol-5-yl)hydrazine.
| Compound Name | (3-methyl-2,3-dihydro-1H-1,2,4-triazol-5-yl)hydrazine |
|---|---|
| PubChem CID | 86232410 |
| Molecular Formula | C3H9N5 |
| Molecular Weight | 115.14 g/mol |
| Exact Mass | 115.09 |
| IUPAC Name | (3-methyl-2,3-dihydro-1H-1,2,4-triazol-5-yl)hydrazine |
| SMILES | CC1N=C(NN)NN1 |
| InChI | InChI=1S/C3H9N5/c1-2-5-3(6-4)8-7-2/h2,7H,4H2,1H3,(H2,5,6,8) |
| InChIKey | XFYIVNFOJXNUIV-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.14 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|