C30H21Br2NSi — CID 86232471
2,8-dibromo-5,10,10-triphenylbenzo[b][1,4]benzazasiline (PubChem CID 86232471) has the molecular formula C30H21Br2NSi and a molecular weight of 583.40 g/mol. Its IUPAC name is 2,8-dibromo-5,10,10-triphenylbenzo[b][1,4]benzazasiline.
| Compound Name | 2,8-dibromo-5,10,10-triphenylbenzo[b][1,4]benzazasiline |
|---|---|
| PubChem CID | 86232471 |
| Molecular Formula | C30H21Br2NSi |
| Molecular Weight | 583.40 g/mol |
| Exact Mass | 580.98 |
| IUPAC Name | 2,8-dibromo-5,10,10-triphenylbenzo[b][1,4]benzazasiline |
| SMILES | Brc1ccc2c(c1)[Si](c1ccccc1)(c1ccccc1)c1cc(Br)ccc1N2c1ccccc1 |
| InChI | InChI=1S/C30H21Br2NSi/c31-22-16-18-27-29(20-22)34(25-12-6-2-7-13-25,26-14-8-3-9-15-26)30-21-23(32)17-19-28(30)33(27)24-10-4-1-5-11-24/h1-21H |
| InChIKey | IUWWFUWGNCZVKG-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.40 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|