C20H31N3O4S — CID 8623270
1-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-[(2R)-2-methylpiperidin-1-yl]ethanone (PubChem CID 8623270) has the molecular formula C20H31N3O4S and a molecular weight of 409.55 g/mol. Its IUPAC name is 1-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-[(2R)-2-methylpiperidin-1-yl]ethanone.
| Compound Name | 1-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-[(2R)-2-methylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 8623270 |
| Molecular Formula | C20H31N3O4S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 1-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-[(2R)-2-methylpiperidin-1-yl]ethanone |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(C(=O)CN3CCCC[C@H]3C)CC2)cc1 |
| InChI | InChI=1S/C20H31N3O4S/c1-3-27-18-7-9-19(10-8-18)28(25,26)23-14-12-21(13-15-23)20(24)16-22-11-5-4-6-17(22)2/h7-10,17H,3-6,11-16H2,1-2H3/t17-/m1/s1 |
| InChIKey | CZTGRVCOKVGEFF-QGZVFWFLSA-N |
| XLogP | 1.79 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |