C8F14O — CID 86233517
1,1,2,3,3,4,5,5,6,6,6-undecafluoro-4-(1,2,2-trifluoroethenoxy)hex-1-ene (PubChem CID 86233517) has the molecular formula C8F14O and a molecular weight of 378.06 g/mol. Its IUPAC name is 1,1,2,3,3,4,5,5,6,6,6-undecafluoro-4-(1,2,2-trifluoroethenoxy)hex-1-ene.
| Compound Name | 1,1,2,3,3,4,5,5,6,6,6-undecafluoro-4-(1,2,2-trifluoroethenoxy)hex-1-ene |
|---|---|
| PubChem CID | 86233517 |
| Molecular Formula | C8F14O |
| Molecular Weight | 378.06 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 1,1,2,3,3,4,5,5,6,6,6-undecafluoro-4-(1,2,2-trifluoroethenoxy)hex-1-ene |
| SMILES | FC(F)=C(F)OC(F)(C(F)(F)C(F)=C(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8F14O/c9-1(2(10)11)5(15,16)7(19,23-4(14)3(12)13)6(17,18)8(20,21)22 |
| InChIKey | SEKZBXLTIOKRAR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.06 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|