About 8-(3,7-dimethyloct-6-enylsulfonyl)-2,6-dimethyloct-2-ene
8-(3,7-dimethyloct-6-enylsulfonyl)-2,6-dimethyloct-2-ene (PubChem CID 86234102) has the molecular formula C20H38O2S
and a molecular weight of 342.59 g/mol. Its IUPAC name is 8-(3,7-dimethyloct-6-enylsulfonyl)-2,6-dimethyloct-2-ene.
Molecular Properties
| Compound Name | 8-(3,7-dimethyloct-6-enylsulfonyl)-2,6-dimethyloct-2-ene |
| PubChem CID | 86234102 |
| Molecular Formula | C20H38O2S |
| Molecular Weight | 342.59 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 8-(3,7-dimethyloct-6-enylsulfonyl)-2,6-dimethyloct-2-ene |
| SMILES | CC(C)=CCCC(C)CCS(=O)(=O)CCC(C)CCC=C(C)C |
| InChI | InChI=1S/C20H38O2S/c1-17(2)9-7-11-19(5)13-15-23(21,22)16-14-20(6)12-8-10-18(3)4/h9-10,19-20H,7-8,11-16H2,1-6H3 |
| InChIKey | HODJWJAZFPGHHF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.59 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-(3,7-dimethyloct-6-enylsulfonyl)-2,6-dimethyloct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3,7-dimethyloct-6-enylsulfonyl)-2,6-dimethyloct-2-ene?
The IUPAC name of 8-(3,7-dimethyloct-6-enylsulfonyl)-2,6-dimethyloct-2-ene (CID 86234102) is 8-(3,7-dimethyloct-6-enylsulfonyl)-2,6-dimethyloct-2-ene.
What is the SMILES notation for 8-(3,7-dimethyloct-6-enylsulfonyl)-2,6-dimethyloct-2-ene?
The canonical SMILES for 8-(3,7-dimethyloct-6-enylsulfonyl)-2,6-dimethyloct-2-ene is CC(C)=CCCC(C)CCS(=O)(=O)CCC(C)CCC=C(C)C.
What is the InChIKey of 8-(3,7-dimethyloct-6-enylsulfonyl)-2,6-dimethyloct-2-ene?
The InChIKey is HODJWJAZFPGHHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O2S/c1-17(2)9-7-11-19(5)13-15-23(21,22)16-14-20(6)12-8-10-18(3)4/h9-10,19-20H,7-8,11-16H2,1-6H3.
What are the key properties of 8-(3,7-dimethyloct-6-enylsulfonyl)-2,6-dimethyloct-2-ene?
8-(3,7-dimethyloct-6-enylsulfonyl)-2,6-dimethyloct-2-ene has a molecular weight of 342.59 g/mol, XLogP of 5.95, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3,7-dimethyloct-6-enylsulfonyl)-2,6-dimethyloct-2-ene is sourced from PubChem (CID 86234102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).