C17H27N2O2+ — CID 8623412
N-[2-(2-methoxyphenyl)ethyl]-2-[(2R)-2-methylpiperidin-1-ium-1-yl]acetamide (PubChem CID 8623412) has the molecular formula C17H27N2O2+ and a molecular weight of 291.41 g/mol. Its IUPAC name is N-[2-(2-methoxyphenyl)ethyl]-2-[(2R)-2-methylpiperidin-1-ium-1-yl]acetamide.
| Compound Name | N-[2-(2-methoxyphenyl)ethyl]-2-[(2R)-2-methylpiperidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8623412 |
| Molecular Formula | C17H27N2O2+ |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | N-[2-(2-methoxyphenyl)ethyl]-2-[(2R)-2-methylpiperidin-1-ium-1-yl]acetamide |
| SMILES | COc1ccccc1CCNC(=O)C[NH+]1CCCC[C@H]1C |
| InChI | InChI=1S/C17H26N2O2/c1-14-7-5-6-12-19(14)13-17(20)18-11-10-15-8-3-4-9-16(15)21-2/h3-4,8-9,14H,5-7,10-13H2,1-2H3,(H,18,20)/p+1/t14-/m1/s1 |
| InChIKey | CKVFDOYQONPCBF-CQSZACIVSA-O |
| XLogP | 0.81 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |