C15H17NO — CID 86234429
6-methyl-5-phenyl-2,3,8,8a-tetrahydro-1H-indolizin-7-one (PubChem CID 86234429) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 6-methyl-5-phenyl-2,3,8,8a-tetrahydro-1H-indolizin-7-one.
| Compound Name | 6-methyl-5-phenyl-2,3,8,8a-tetrahydro-1H-indolizin-7-one |
|---|---|
| PubChem CID | 86234429 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 6-methyl-5-phenyl-2,3,8,8a-tetrahydro-1H-indolizin-7-one |
| SMILES | CC1=C(c2ccccc2)N2CCCC2CC1=O |
| InChI | InChI=1S/C15H17NO/c1-11-14(17)10-13-8-5-9-16(13)15(11)12-6-3-2-4-7-12/h2-4,6-7,13H,5,8-10H2,1H3 |
| InChIKey | VTUVVGADDCXFQO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |