About N,N-dimethoxymethanamine;hydrochloride
N,N-dimethoxymethanamine;hydrochloride (PubChem CID 86234956) has the molecular formula C3H10ClNO2
and a molecular weight of 127.57 g/mol. Its IUPAC name is N,N-dimethoxymethanamine;hydrochloride.
Molecular Properties
| Compound Name | N,N-dimethoxymethanamine;hydrochloride |
| PubChem CID | 86234956 |
| Molecular Formula | C3H10ClNO2 |
| Molecular Weight | 127.57 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | N,N-dimethoxymethanamine;hydrochloride |
| SMILES | CON(C)OC.Cl |
| InChI | InChI=1S/C3H9NO2.ClH/c1-4(5-2)6-3;/h1-3H3;1H |
| InChIKey | ADRBBCQLSWSOTC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.57 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethoxymethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethoxymethanamine;hydrochloride?
The IUPAC name of N,N-dimethoxymethanamine;hydrochloride (CID 86234956) is N,N-dimethoxymethanamine;hydrochloride.
What is the SMILES notation for N,N-dimethoxymethanamine;hydrochloride?
The canonical SMILES for N,N-dimethoxymethanamine;hydrochloride is CON(C)OC.Cl.
What is the InChIKey of N,N-dimethoxymethanamine;hydrochloride?
The InChIKey is ADRBBCQLSWSOTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO2.ClH/c1-4(5-2)6-3;/h1-3H3;1H.
What are the key properties of N,N-dimethoxymethanamine;hydrochloride?
N,N-dimethoxymethanamine;hydrochloride has a molecular weight of 127.57 g/mol, XLogP of 0.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethoxymethanamine;hydrochloride is sourced from PubChem (CID 86234956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).