C14H19N5 — CID 86235846
2-N,2-N-diethyl-4-N-phenylpyrimidine-2,4,6-triamine (PubChem CID 86235846) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-N,2-N-diethyl-4-N-phenylpyrimidine-2,4,6-triamine.
| Compound Name | 2-N,2-N-diethyl-4-N-phenylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 86235846 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-N,2-N-diethyl-4-N-phenylpyrimidine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(N)cc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C14H19N5/c1-3-19(4-2)14-17-12(15)10-13(18-14)16-11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3,(H3,15,16,17,18) |
| InChIKey | LRQGGHACHWIIOY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |