C7H8F3NO3 — CID 86235977
(1-acetylazetidin-3-yl) 2,2,2-trifluoroacetate (PubChem CID 86235977) has the molecular formula C7H8F3NO3 and a molecular weight of 211.14 g/mol. Its IUPAC name is (1-acetylazetidin-3-yl) 2,2,2-trifluoroacetate.
| Compound Name | (1-acetylazetidin-3-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 86235977 |
| Molecular Formula | C7H8F3NO3 |
| Molecular Weight | 211.14 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | (1-acetylazetidin-3-yl) 2,2,2-trifluoroacetate |
| SMILES | CC(=O)N1CC(OC(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C7H8F3NO3/c1-4(12)11-2-5(3-11)14-6(13)7(8,9)10/h5H,2-3H2,1H3 |
| InChIKey | LHMLHIORBCQIOF-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.14 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |