About 1-methyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole
1-methyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole (PubChem CID 86238304) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-methyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole.
Analyze 1-methyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole?
The IUPAC name of 1-methyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole (CID 86238304) is 1-methyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole.
What is the SMILES notation for 1-methyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole?
The canonical SMILES for 1-methyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole is Cn1ncc2c1CCCCCC2.
What is the InChIKey of 1-methyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole?
The InChIKey is NYSOUZDSWHHHPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2/c1-12-10-7-5-3-2-4-6-9(10)8-11-12/h8H,2-7H2,1H3.
What are the key properties of 1-methyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole?
1-methyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole has a molecular weight of 164.25 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole is sourced from PubChem (CID 86238304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).