C10H14F5NO3S — CID 86238576
ethyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate (PubChem CID 86238576) has the molecular formula C10H14F5NO3S and a molecular weight of 323.28 g/mol. Its IUPAC name is ethyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate.
| Compound Name | ethyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
|---|---|
| PubChem CID | 86238576 |
| Molecular Formula | C10H14F5NO3S |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | ethyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
| SMILES | CCOC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F5NO3S/c1-3-19-7(17)6(4-5-20-2)16-8(18)9(11,12)10(13,14)15/h6H,3-5H2,1-2H3,(H,16,18) |
| InChIKey | BTWCDYIZXWZLDF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|