C13H20F5NO3 — CID 86238579
2-methylpropyl 4-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)pentanoate (PubChem CID 86238579) has the molecular formula C13H20F5NO3 and a molecular weight of 333.30 g/mol. Its IUPAC name is 2-methylpropyl 4-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)pentanoate.
| Compound Name | 2-methylpropyl 4-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)pentanoate |
|---|---|
| PubChem CID | 86238579 |
| Molecular Formula | C13H20F5NO3 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 2-methylpropyl 4-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)pentanoate |
| SMILES | CC(C)COC(=O)C(CC(C)C)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H20F5NO3/c1-7(2)5-9(10(20)22-6-8(3)4)19-11(21)12(14,15)13(16,17)18/h7-9H,5-6H2,1-4H3,(H,19,21) |
| InChIKey | DFESLQPMOKIBIT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|