C12H18F5NO3 — CID 86238640
2-methylpropyl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate (PubChem CID 86238640) has the molecular formula C12H18F5NO3 and a molecular weight of 319.27 g/mol. Its IUPAC name is 2-methylpropyl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate.
| Compound Name | 2-methylpropyl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
|---|---|
| PubChem CID | 86238640 |
| Molecular Formula | C12H18F5NO3 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-methylpropyl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
| SMILES | CC(C)COC(=O)C(NC(=O)C(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C12H18F5NO3/c1-6(2)5-21-9(19)8(7(3)4)18-10(20)11(13,14)12(15,16)17/h6-8H,5H2,1-4H3,(H,18,20) |
| InChIKey | WUZWOHTXIXAPDX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|