C17H18F7NO3 — CID 86238647
butyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-phenylpropanoate (PubChem CID 86238647) has the molecular formula C17H18F7NO3 and a molecular weight of 417.32 g/mol. Its IUPAC name is butyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-phenylpropanoate.
| Compound Name | butyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 86238647 |
| Molecular Formula | C17H18F7NO3 |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | butyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-phenylpropanoate |
| SMILES | CCCCOC(=O)C(Cc1ccccc1)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H18F7NO3/c1-2-3-9-28-13(26)12(10-11-7-5-4-6-8-11)25-14(27)15(18,19)16(20,21)17(22,23)24/h4-8,12H,2-3,9-10H2,1H3,(H,25,27) |
| InChIKey | OCQYHUKFEDQUNZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|