C11H14F7NO3S — CID 86238650
ethyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoate (PubChem CID 86238650) has the molecular formula C11H14F7NO3S and a molecular weight of 373.29 g/mol. Its IUPAC name is ethyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoate.
| Compound Name | ethyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 86238650 |
| Molecular Formula | C11H14F7NO3S |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | ethyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoate |
| SMILES | CCOC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F7NO3S/c1-3-22-7(20)6(4-5-23-2)19-8(21)9(12,13)10(14,15)11(16,17)18/h6H,3-5H2,1-2H3,(H,19,21) |
| InChIKey | YACKYESRXIZBCN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|