C19H24N2O5S — CID 8624005
N'-(4-ethoxyphenyl)sulfonyl-3-(2-methylpropoxy)benzohydrazide (PubChem CID 8624005) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is N'-(4-ethoxyphenyl)sulfonyl-3-(2-methylpropoxy)benzohydrazide.
| Compound Name | N'-(4-ethoxyphenyl)sulfonyl-3-(2-methylpropoxy)benzohydrazide |
|---|---|
| PubChem CID | 8624005 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N'-(4-ethoxyphenyl)sulfonyl-3-(2-methylpropoxy)benzohydrazide |
| SMILES | CCOc1ccc(S(=O)(=O)NNC(=O)c2cccc(OCC(C)C)c2)cc1 |
| InChI | InChI=1S/C19H24N2O5S/c1-4-25-16-8-10-18(11-9-16)27(23,24)21-20-19(22)15-6-5-7-17(12-15)26-13-14(2)3/h5-12,14,21H,4,13H2,1-3H3,(H,20,22) |
| InChIKey | WIQUDYGKDZTXOZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|