About methyl 4-(1-azidoethyl)benzoate
methyl 4-(1-azidoethyl)benzoate (PubChem CID 86240144) has the molecular formula C10H11N3O2
and a molecular weight of 205.22 g/mol. Its IUPAC name is methyl 4-(1-azidoethyl)benzoate.
Molecular Properties
| Compound Name | methyl 4-(1-azidoethyl)benzoate |
| PubChem CID | 86240144 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | methyl 4-(1-azidoethyl)benzoate |
| SMILES | COC(=O)c1ccc(C(C)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C10H11N3O2/c1-7(12-13-11)8-3-5-9(6-4-8)10(14)15-2/h3-7H,1-2H3 |
| InChIKey | PNYJDKRGKXPKRX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(1-azidoethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(1-azidoethyl)benzoate?
The IUPAC name of methyl 4-(1-azidoethyl)benzoate (CID 86240144) is methyl 4-(1-azidoethyl)benzoate.
What is the SMILES notation for methyl 4-(1-azidoethyl)benzoate?
The canonical SMILES for methyl 4-(1-azidoethyl)benzoate is COC(=O)c1ccc(C(C)N=[N+]=[N-])cc1.
What is the InChIKey of methyl 4-(1-azidoethyl)benzoate?
The InChIKey is PNYJDKRGKXPKRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2/c1-7(12-13-11)8-3-5-9(6-4-8)10(14)15-2/h3-7H,1-2H3.
What are the key properties of methyl 4-(1-azidoethyl)benzoate?
methyl 4-(1-azidoethyl)benzoate has a molecular weight of 205.22 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1-azidoethyl)benzoate is sourced from PubChem (CID 86240144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).