C19H24N2O2Si — CID 86240643
trimethyl-[2-[(4-phenoxypyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl]silane (PubChem CID 86240643) has the molecular formula C19H24N2O2Si and a molecular weight of 340.50 g/mol. Its IUPAC name is trimethyl-[2-[(4-phenoxypyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[(4-phenoxypyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl]silane |
|---|---|
| PubChem CID | 86240643 |
| Molecular Formula | C19H24N2O2Si |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | trimethyl-[2-[(4-phenoxypyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(Oc3ccccc3)ccnc21 |
| InChI | InChI=1S/C19H24N2O2Si/c1-24(2,3)14-13-22-15-21-12-10-17-18(9-11-20-19(17)21)23-16-7-5-4-6-8-16/h4-12H,13-15H2,1-3H3 |
| InChIKey | BGIBVHQBSQGENV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|