C18H24N6 — CID 86240753
1-N,4-N-bis[(3,5-dimethylpyrazol-1-yl)methyl]benzene-1,4-diamine (PubChem CID 86240753) has the molecular formula C18H24N6 and a molecular weight of 324.43 g/mol. Its IUPAC name is 1-N,4-N-bis[(3,5-dimethylpyrazol-1-yl)methyl]benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis[(3,5-dimethylpyrazol-1-yl)methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 86240753 |
| Molecular Formula | C18H24N6 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 1-N,4-N-bis[(3,5-dimethylpyrazol-1-yl)methyl]benzene-1,4-diamine |
| SMILES | Cc1cc(C)n(CNc2ccc(NCn3nc(C)cc3C)cc2)n1 |
| InChI | InChI=1S/C18H24N6/c1-13-9-15(3)23(21-13)11-19-17-5-7-18(8-6-17)20-12-24-16(4)10-14(2)22-24/h5-10,19-20H,11-12H2,1-4H3 |
| InChIKey | QZHZOURVHUVCNN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |