About 1-[(3,3-dimethylcyclohexen-1-yl)methyl]-1,3-dithian-1-ium
1-[(3,3-dimethylcyclohexen-1-yl)methyl]-1,3-dithian-1-ium (PubChem CID 86241907) has the molecular formula C13H23S2+
and a molecular weight of 243.46 g/mol. Its IUPAC name is 1-[(3,3-dimethylcyclohexen-1-yl)methyl]-1,3-dithian-1-ium.
Molecular Properties
| Compound Name | 1-[(3,3-dimethylcyclohexen-1-yl)methyl]-1,3-dithian-1-ium |
| PubChem CID | 86241907 |
| Molecular Formula | C13H23S2+ |
| Molecular Weight | 243.46 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 1-[(3,3-dimethylcyclohexen-1-yl)methyl]-1,3-dithian-1-ium |
| SMILES | CC1(C)C=C(C[S+]2CCCSC2)CCC1 |
| InChI | InChI=1S/C13H23S2/c1-13(2)6-3-5-12(9-13)10-15-8-4-7-14-11-15/h9H,3-8,10-11H2,1-2H3/q+1 |
| InChIKey | OWEAVBXAJKPXSM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,3-dimethylcyclohexen-1-yl)methyl]-1,3-dithian-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,3-dimethylcyclohexen-1-yl)methyl]-1,3-dithian-1-ium?
The IUPAC name of 1-[(3,3-dimethylcyclohexen-1-yl)methyl]-1,3-dithian-1-ium (CID 86241907) is 1-[(3,3-dimethylcyclohexen-1-yl)methyl]-1,3-dithian-1-ium.
What is the SMILES notation for 1-[(3,3-dimethylcyclohexen-1-yl)methyl]-1,3-dithian-1-ium?
The canonical SMILES for 1-[(3,3-dimethylcyclohexen-1-yl)methyl]-1,3-dithian-1-ium is CC1(C)C=C(C[S+]2CCCSC2)CCC1.
What is the InChIKey of 1-[(3,3-dimethylcyclohexen-1-yl)methyl]-1,3-dithian-1-ium?
The InChIKey is OWEAVBXAJKPXSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23S2/c1-13(2)6-3-5-12(9-13)10-15-8-4-7-14-11-15/h9H,3-8,10-11H2,1-2H3/q+1.
What are the key properties of 1-[(3,3-dimethylcyclohexen-1-yl)methyl]-1,3-dithian-1-ium?
1-[(3,3-dimethylcyclohexen-1-yl)methyl]-1,3-dithian-1-ium has a molecular weight of 243.46 g/mol, XLogP of 3.84, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,3-dimethylcyclohexen-1-yl)methyl]-1,3-dithian-1-ium is sourced from PubChem (CID 86241907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).