C20H21NO3 — CID 86242003
8,10-dimethoxy-3,3,5-trimethyl-11H-pyrano[3,2-a]carbazole (PubChem CID 86242003) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 8,10-dimethoxy-3,3,5-trimethyl-11H-pyrano[3,2-a]carbazole.
| Compound Name | 8,10-dimethoxy-3,3,5-trimethyl-11H-pyrano[3,2-a]carbazole |
|---|---|
| PubChem CID | 86242003 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 8,10-dimethoxy-3,3,5-trimethyl-11H-pyrano[3,2-a]carbazole |
| SMILES | COc1cc(OC)c2[nH]c3c4c(c(C)cc3c2c1)OC(C)(C)C=C4 |
| InChI | InChI=1S/C20H21NO3/c1-11-8-14-15-9-12(22-4)10-16(23-5)18(15)21-17(14)13-6-7-20(2,3)24-19(11)13/h6-10,21H,1-5H3 |
| InChIKey | APZRRMFSHXMDTQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |