C11H13F3N2O3S — CID 86242153
2,2,2-trifluoro-1-[2-(2-sulfanylidene-1,3-oxazolidine-3-carbonyl)piperidin-1-yl]ethanone (PubChem CID 86242153) has the molecular formula C11H13F3N2O3S and a molecular weight of 310.30 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-(2-sulfanylidene-1,3-oxazolidine-3-carbonyl)piperidin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[2-(2-sulfanylidene-1,3-oxazolidine-3-carbonyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 86242153 |
| Molecular Formula | C11H13F3N2O3S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-(2-sulfanylidene-1,3-oxazolidine-3-carbonyl)piperidin-1-yl]ethanone |
| SMILES | O=C(C1CCCCN1C(=O)C(F)(F)F)N1CCOC1=S |
| InChI | InChI=1S/C11H13F3N2O3S/c12-11(13,14)9(18)15-4-2-1-3-7(15)8(17)16-5-6-19-10(16)20/h7H,1-6H2 |
| InChIKey | LKKSDAMXHKPBOB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|