About 6-iodo-7-propyl-2,3-dihydro-1H-indolizin-5-one
6-iodo-7-propyl-2,3-dihydro-1H-indolizin-5-one (PubChem CID 86245053) has the molecular formula C11H14INO
and a molecular weight of 303.14 g/mol. Its IUPAC name is 6-iodo-7-propyl-2,3-dihydro-1H-indolizin-5-one.
Molecular Properties
| Compound Name | 6-iodo-7-propyl-2,3-dihydro-1H-indolizin-5-one |
| PubChem CID | 86245053 |
| Molecular Formula | C11H14INO |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 6-iodo-7-propyl-2,3-dihydro-1H-indolizin-5-one |
| SMILES | CCCc1cc2n(c(=O)c1I)CCC2 |
| InChI | InChI=1S/C11H14INO/c1-2-4-8-7-9-5-3-6-13(9)11(14)10(8)12/h7H,2-6H2,1H3 |
| InChIKey | WKYVOJKZLOQMSJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-7-propyl-2,3-dihydro-1H-indolizin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-7-propyl-2,3-dihydro-1H-indolizin-5-one?
The IUPAC name of 6-iodo-7-propyl-2,3-dihydro-1H-indolizin-5-one (CID 86245053) is 6-iodo-7-propyl-2,3-dihydro-1H-indolizin-5-one.
What is the SMILES notation for 6-iodo-7-propyl-2,3-dihydro-1H-indolizin-5-one?
The canonical SMILES for 6-iodo-7-propyl-2,3-dihydro-1H-indolizin-5-one is CCCc1cc2n(c(=O)c1I)CCC2.
What is the InChIKey of 6-iodo-7-propyl-2,3-dihydro-1H-indolizin-5-one?
The InChIKey is WKYVOJKZLOQMSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14INO/c1-2-4-8-7-9-5-3-6-13(9)11(14)10(8)12/h7H,2-6H2,1H3.
What are the key properties of 6-iodo-7-propyl-2,3-dihydro-1H-indolizin-5-one?
6-iodo-7-propyl-2,3-dihydro-1H-indolizin-5-one has a molecular weight of 303.14 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-7-propyl-2,3-dihydro-1H-indolizin-5-one is sourced from PubChem (CID 86245053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).