About (4-chlorophenyl)methyl 4-methylbenzenesulfinate
(4-chlorophenyl)methyl 4-methylbenzenesulfinate (PubChem CID 86245301) has the molecular formula C14H13ClO2S
and a molecular weight of 280.78 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 4-methylbenzenesulfinate.
Molecular Properties
| Compound Name | (4-chlorophenyl)methyl 4-methylbenzenesulfinate |
| PubChem CID | 86245301 |
| Molecular Formula | C14H13ClO2S |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | (4-chlorophenyl)methyl 4-methylbenzenesulfinate |
| SMILES | Cc1ccc(S(=O)OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C14H13ClO2S/c1-11-2-8-14(9-3-11)18(16)17-10-12-4-6-13(15)7-5-12/h2-9H,10H2,1H3 |
| InChIKey | MVZXQVJEEZZJMO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-chlorophenyl)methyl 4-methylbenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methyl 4-methylbenzenesulfinate?
The IUPAC name of (4-chlorophenyl)methyl 4-methylbenzenesulfinate (CID 86245301) is (4-chlorophenyl)methyl 4-methylbenzenesulfinate.
What is the SMILES notation for (4-chlorophenyl)methyl 4-methylbenzenesulfinate?
The canonical SMILES for (4-chlorophenyl)methyl 4-methylbenzenesulfinate is Cc1ccc(S(=O)OCc2ccc(Cl)cc2)cc1.
What is the InChIKey of (4-chlorophenyl)methyl 4-methylbenzenesulfinate?
The InChIKey is MVZXQVJEEZZJMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClO2S/c1-11-2-8-14(9-3-11)18(16)17-10-12-4-6-13(15)7-5-12/h2-9H,10H2,1H3.
What are the key properties of (4-chlorophenyl)methyl 4-methylbenzenesulfinate?
(4-chlorophenyl)methyl 4-methylbenzenesulfinate has a molecular weight of 280.78 g/mol, XLogP of 3.89, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl 4-methylbenzenesulfinate is sourced from PubChem (CID 86245301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).