C9H12F6N2O2 — CID 86245682
N,N-bis(2,2,2-trifluoroethyl)morpholine-2-carboxamide (PubChem CID 86245682) has the molecular formula C9H12F6N2O2 and a molecular weight of 294.20 g/mol. Its IUPAC name is N,N-bis(2,2,2-trifluoroethyl)morpholine-2-carboxamide.
| Compound Name | N,N-bis(2,2,2-trifluoroethyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 86245682 |
| Molecular Formula | C9H12F6N2O2 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N,N-bis(2,2,2-trifluoroethyl)morpholine-2-carboxamide |
| SMILES | O=C(C1CNCCO1)N(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C9H12F6N2O2/c10-8(11,12)4-17(5-9(13,14)15)7(18)6-3-16-1-2-19-6/h6,16H,1-5H2 |
| InChIKey | JZRCBSDAMHBHDY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |