About 2-[(4-ethylpiperazin-1-yl)methyl]-3,5,6-trimethylpyrazine
2-[(4-ethylpiperazin-1-yl)methyl]-3,5,6-trimethylpyrazine (PubChem CID 86247352) has the molecular formula C14H24N4
and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-[(4-ethylpiperazin-1-yl)methyl]-3,5,6-trimethylpyrazine.
Molecular Properties
| Compound Name | 2-[(4-ethylpiperazin-1-yl)methyl]-3,5,6-trimethylpyrazine |
| PubChem CID | 86247352 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 2-[(4-ethylpiperazin-1-yl)methyl]-3,5,6-trimethylpyrazine |
| SMILES | CCN1CCN(Cc2nc(C)c(C)nc2C)CC1 |
| InChI | InChI=1S/C14H24N4/c1-5-17-6-8-18(9-7-17)10-14-13(4)15-11(2)12(3)16-14/h5-10H2,1-4H3 |
| InChIKey | UZJCQBXDMUJBSD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-ethylpiperazin-1-yl)methyl]-3,5,6-trimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-ethylpiperazin-1-yl)methyl]-3,5,6-trimethylpyrazine?
The IUPAC name of 2-[(4-ethylpiperazin-1-yl)methyl]-3,5,6-trimethylpyrazine (CID 86247352) is 2-[(4-ethylpiperazin-1-yl)methyl]-3,5,6-trimethylpyrazine.
What is the SMILES notation for 2-[(4-ethylpiperazin-1-yl)methyl]-3,5,6-trimethylpyrazine?
The canonical SMILES for 2-[(4-ethylpiperazin-1-yl)methyl]-3,5,6-trimethylpyrazine is CCN1CCN(Cc2nc(C)c(C)nc2C)CC1.
What is the InChIKey of 2-[(4-ethylpiperazin-1-yl)methyl]-3,5,6-trimethylpyrazine?
The InChIKey is UZJCQBXDMUJBSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4/c1-5-17-6-8-18(9-7-17)10-14-13(4)15-11(2)12(3)16-14/h5-10H2,1-4H3.
What are the key properties of 2-[(4-ethylpiperazin-1-yl)methyl]-3,5,6-trimethylpyrazine?
2-[(4-ethylpiperazin-1-yl)methyl]-3,5,6-trimethylpyrazine has a molecular weight of 248.37 g/mol, XLogP of 1.54, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-ethylpiperazin-1-yl)methyl]-3,5,6-trimethylpyrazine is sourced from PubChem (CID 86247352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).