About ethyl-[4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)phenyl]cyanamide
ethyl-[4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)phenyl]cyanamide (PubChem CID 86249762) has the molecular formula C15H12N6S
and a molecular weight of 308.37 g/mol. Its IUPAC name is ethyl-[4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)phenyl]cyanamide.
Molecular Properties
| Compound Name | ethyl-[4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)phenyl]cyanamide |
| PubChem CID | 86249762 |
| Molecular Formula | C15H12N6S |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | ethyl-[4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)phenyl]cyanamide |
| SMILES | CCN(C#N)c1ccc(/N=N/c2nc3ccncc3s2)cc1 |
| InChI | InChI=1S/C15H12N6S/c1-2-21(10-16)12-5-3-11(4-6-12)19-20-15-18-13-7-8-17-9-14(13)22-15/h3-9H,2H2,1H3/b20-19+ |
| InChIKey | POSBKZXRQFASSZ-FMQUCBEESA-N |
| XLogP | 4.41 |
| TPSA | 77.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze ethyl-[4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)phenyl]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-[4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)phenyl]cyanamide?
The IUPAC name of ethyl-[4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)phenyl]cyanamide (CID 86249762) is ethyl-[4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)phenyl]cyanamide.
What is the SMILES notation for ethyl-[4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)phenyl]cyanamide?
The canonical SMILES for ethyl-[4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)phenyl]cyanamide is CCN(C#N)c1ccc(/N=N/c2nc3ccncc3s2)cc1.
What is the InChIKey of ethyl-[4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)phenyl]cyanamide?
The InChIKey is POSBKZXRQFASSZ-FMQUCBEESA-N. The full InChI is InChI=1S/C15H12N6S/c1-2-21(10-16)12-5-3-11(4-6-12)19-20-15-18-13-7-8-17-9-14(13)22-15/h3-9H,2H2,1H3/b20-19+.
What are the key properties of ethyl-[4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)phenyl]cyanamide?
ethyl-[4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)phenyl]cyanamide has a molecular weight of 308.37 g/mol, XLogP of 4.41, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-[4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)phenyl]cyanamide is sourced from PubChem (CID 86249762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).