C14H12N2O — CID 86253335
2-benzo[h][1,6]naphthyridin-4-ylethanol (PubChem CID 86253335) has the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-benzo[h][1,6]naphthyridin-4-ylethanol.
| Compound Name | 2-benzo[h][1,6]naphthyridin-4-ylethanol |
|---|---|
| PubChem CID | 86253335 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-benzo[h][1,6]naphthyridin-4-ylethanol |
| SMILES | OCCc1ccnc2c1cnc1ccccc12 |
| InChI | InChI=1S/C14H12N2O/c17-8-6-10-5-7-15-14-11-3-1-2-4-13(11)16-9-12(10)14/h1-5,7,9,17H,6,8H2 |
| InChIKey | WKKWOYZDMSEQOB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|