C9H10ClN3O5 — CID 86255042
1-chloro-3,5-bis(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 86255042) has the molecular formula C9H10ClN3O5 and a molecular weight of 275.65 g/mol. Its IUPAC name is 1-chloro-3,5-bis(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-chloro-3,5-bis(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 86255042 |
| Molecular Formula | C9H10ClN3O5 |
| Molecular Weight | 275.65 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 1-chloro-3,5-bis(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(Cl)c(=O)n(CC2CO2)c(=O)n1CC1CO1 |
| InChI | InChI=1S/C9H10ClN3O5/c10-13-8(15)11(1-5-3-17-5)7(14)12(9(13)16)2-6-4-18-6/h5-6H,1-4H2 |
| InChIKey | PGOHJNLBAGFTEQ-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 91.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.65 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|